C22H35NO4 — CID 16732805
[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl N-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methoxycarbonyl]carbamate (PubChem CID 16732805) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is [(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl N-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methoxycarbonyl]carbamate.
| Compound Name | [(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl N-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methoxycarbonyl]carbamate |
|---|---|
| PubChem CID | 16732805 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | [(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl N-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methoxycarbonyl]carbamate |
| SMILES | CC1(C)[C@H]2CC[C@@H](COC(=O)NC(=O)OC[C@@H]3CC[C@H]4C[C@@H]3C4(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C22H35NO4/c1-21(2)15-7-5-13(17(21)9-15)11-26-19(24)23-20(25)27-12-14-6-8-16-10-18(14)22(16,3)4/h13-18H,5-12H2,1-4H3,(H,23,24,25)/t13-,14-,15-,16-,17-,18-/m0/s1 |
| InChIKey | YLCWWPNWWQMQGO-QQCJEOGWSA-N |
| XLogP | 4.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |