C13H24OS — CID 19762350
2-[2-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)ethylsulfanyl]ethanol (PubChem CID 19762350) has the molecular formula C13H24OS and a molecular weight of 228.40 g/mol. Its IUPAC name is 2-[2-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)ethylsulfanyl]ethanol.
| Compound Name | 2-[2-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)ethylsulfanyl]ethanol |
|---|---|
| PubChem CID | 19762350 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-[2-(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)ethylsulfanyl]ethanol |
| SMILES | CC1(C)C2CCC(CCSCCO)C1C2 |
| InChI | InChI=1S/C13H24OS/c1-13(2)11-4-3-10(12(13)9-11)5-7-15-8-6-14/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | JEDDGAWCRBNPCW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|