C10H17ClHg — CID 131877018
chloro-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]mercury (PubChem CID 131877018) has the molecular formula C10H17ClHg and a molecular weight of 373.29 g/mol. Its IUPAC name is chloro-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]mercury.
| Compound Name | chloro-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]mercury |
|---|---|
| PubChem CID | 131877018 |
| Molecular Formula | C10H17ClHg |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | chloro-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]mercury |
| SMILES | CC1(C)[C@H]2CC[C@@H](C[Hg]Cl)[C@@H]1C2 |
| InChI | InChI=1S/C10H17.ClH.Hg/c1-7-4-5-8-6-9(7)10(8,2)3;;/h7-9H,1,4-6H2,2-3H3;1H;/q;;+1/p-1/t7-,8+,9+;;/m1../s1 |
| InChIKey | GYLHPGHCTDYPPS-IRDIGYRESA-M |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|