C14H27B — CID 11830577
[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl-diethylborane (PubChem CID 11830577) has the molecular formula C14H27B and a molecular weight of 206.18 g/mol. Its IUPAC name is [(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl-diethylborane.
| Compound Name | [(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl-diethylborane |
|---|---|
| PubChem CID | 11830577 |
| Molecular Formula | C14H27B |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.22 |
| IUPAC Name | [(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl-diethylborane |
| SMILES | CCB(CC)C[C@@H]1CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C14H27B/c1-5-15(6-2)10-11-7-8-12-9-13(11)14(12,3)4/h11-13H,5-10H2,1-4H3/t11-,12-,13-/m0/s1 |
| InChIKey | UXEXYTMDAFVFSI-AVGNSLFASA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|