About hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium
hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium (PubChem CID 67130993) has the molecular formula C12H15N+2
and a molecular weight of 173.26 g/mol. Its IUPAC name is hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium.
Molecular Properties
| Compound Name | hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium |
| PubChem CID | 67130993 |
| Molecular Formula | C12H15N+2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium |
| SMILES | C=CC[N+]1=Cc2ccccc2CC1.[H+] |
| InChI | InChI=1S/C12H14N/c1-2-8-13-9-7-11-5-3-4-6-12(11)10-13/h2-6,10H,1,7-9H2/q+1/p+1 |
| InChIKey | CNVZFJVHQGMZOR-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium?
The IUPAC name of hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium (CID 67130993) is hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium.
What is the SMILES notation for hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium?
The canonical SMILES for hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium is C=CC[N+]1=Cc2ccccc2CC1.[H+].
What is the InChIKey of hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium?
The InChIKey is CNVZFJVHQGMZOR-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H14N/c1-2-8-13-9-7-11-5-3-4-6-12(11)10-13/h2-6,10H,1,7-9H2/q+1/p+1.
What are the key properties of hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium?
hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium has a molecular weight of 173.26 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium is sourced from PubChem (CID 67130993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).