C12H15N+2 — CID 67130993
hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium (PubChem CID 67130993) has the molecular formula C12H15N+2 and a molecular weight of 173.26 g/mol. Its IUPAC name is hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium.
| Compound Name | hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 67130993 |
| Molecular Formula | C12H15N+2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | hydron;2-prop-2-enyl-3,4-dihydroisoquinolin-2-ium |
| SMILES | C=CC[N+]1=Cc2ccccc2CC1.[H+] |
| InChI | InChI=1S/C12H14N/c1-2-8-13-9-7-11-5-3-4-6-12(11)10-13/h2-6,10H,1,7-9H2/q+1/p+1 |
| InChIKey | CNVZFJVHQGMZOR-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|