C11H13N — CID 3245338
1,3-dimethyl-3,4-dihydroisoquinoline (PubChem CID 3245338) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 1,3-dimethyl-3,4-dihydroisoquinoline.
| Compound Name | 1,3-dimethyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 3245338 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1,3-dimethyl-3,4-dihydroisoquinoline |
| SMILES | CC1=NC(C)Cc2ccccc21 |
| InChI | InChI=1S/C11H13N/c1-8-7-10-5-3-4-6-11(10)9(2)12-8/h3-6,8H,7H2,1-2H3 |
| InChIKey | MFRSLKXLFAZRBP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |