C17H20O3 — CID 117071026
(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl) 2-oxo-2-phenylacetate (PubChem CID 117071026) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (6,6-dimethyl-2-bicyclo[3.1.1]heptanyl) 2-oxo-2-phenylacetate.
| Compound Name | (6,6-dimethyl-2-bicyclo[3.1.1]heptanyl) 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 117071026 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (6,6-dimethyl-2-bicyclo[3.1.1]heptanyl) 2-oxo-2-phenylacetate |
| SMILES | CC1(C)C2CCC(OC(=O)C(=O)c3ccccc3)C1C2 |
| InChI | InChI=1S/C17H20O3/c1-17(2)12-8-9-14(13(17)10-12)20-16(19)15(18)11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3 |
| InChIKey | PDPSLTJXVYCWHQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|