C20H24O3 — CID 101392434
[(1S,2R,4R)-7,7-dimethyl-1-prop-2-enyl-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate (PubChem CID 101392434) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(1S,2R,4R)-7,7-dimethyl-1-prop-2-enyl-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate.
| Compound Name | [(1S,2R,4R)-7,7-dimethyl-1-prop-2-enyl-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate |
|---|---|
| PubChem CID | 101392434 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | [(1S,2R,4R)-7,7-dimethyl-1-prop-2-enyl-2-bicyclo[2.2.1]heptanyl] 2-oxo-2-phenylacetate |
| SMILES | C=CC[C@]12CC[C@H](C[C@H]1OC(=O)C(=O)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C20H24O3/c1-4-11-20-12-10-15(19(20,2)3)13-16(20)23-18(22)17(21)14-8-6-5-7-9-14/h4-9,15-16H,1,10-13H2,2-3H3/t15-,16-,20+/m1/s1 |
| InChIKey | PXFWPYPFIOVPFA-QINHECLXSA-N |
| XLogP | 4.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|