C25H28O4 — CID 100992403
[(1R,2S,4S)-1-[hydroxy(diphenyl)methyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxopropanoate (PubChem CID 100992403) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is [(1R,2S,4S)-1-[hydroxy(diphenyl)methyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxopropanoate.
| Compound Name | [(1R,2S,4S)-1-[hydroxy(diphenyl)methyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxopropanoate |
|---|---|
| PubChem CID | 100992403 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [(1R,2S,4S)-1-[hydroxy(diphenyl)methyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-oxopropanoate |
| SMILES | CC(=O)C(=O)O[C@H]1C[C@@H]2CC[C@@]1(C(O)(c1ccccc1)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C25H28O4/c1-17(26)22(27)29-21-16-20-14-15-24(21,23(20,2)3)25(28,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,20-21,28H,14-16H2,1-3H3/t20-,21-,24-/m0/s1 |
| InChIKey | LYTYZGAYPXOCRX-HFMPRLQTSA-N |
| XLogP | 4.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|