C42H47O5PS — CID 11262522
[(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5,5-dimethyl-3-oxo-2-(triphenyl-lambda5-phosphanylidene)hexanoate (PubChem CID 11262522) has the molecular formula C42H47O5PS and a molecular weight of 694.87 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5,5-dimethyl-3-oxo-2-(triphenyl-lambda5-phosphanylidene)hexanoate.
| Compound Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5,5-dimethyl-3-oxo-2-(triphenyl-lambda5-phosphanylidene)hexanoate |
|---|---|
| PubChem CID | 11262522 |
| Molecular Formula | C42H47O5PS |
| Molecular Weight | 694.87 g/mol |
| Exact Mass | 694.29 |
| IUPAC Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5,5-dimethyl-3-oxo-2-(triphenyl-lambda5-phosphanylidene)hexanoate |
| SMILES | CC(C)(C)CC(=O)C(C(=O)O[C@H]1C[C@@H]2CC[C@@]1(CS(=O)(=O)c1ccccc1)C2(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H47O5PS/c1-40(2,3)29-36(43)38(48(32-18-10-6-11-19-32,33-20-12-7-13-21-33)34-22-14-8-15-23-34)39(44)47-37-28-31-26-27-42(37,41(31,4)5)30-49(45,46)35-24-16-9-17-25-35/h6-25,31,37H,26-30H2,1-5H3/t31-,37-,42-/m0/s1 |
| InChIKey | DMMGPHVUYXSTJN-FRUNYSLASA-N |
| XLogP | 7.37 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.87 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|