C27H30O4S — CID 101370178
[(1R,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-phenylpenta-2,3-dienoate (PubChem CID 101370178) has the molecular formula C27H30O4S and a molecular weight of 450.60 g/mol. Its IUPAC name is [(1R,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-phenylpenta-2,3-dienoate.
| Compound Name | [(1R,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-phenylpenta-2,3-dienoate |
|---|---|
| PubChem CID | 101370178 |
| Molecular Formula | C27H30O4S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [(1R,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-phenylpenta-2,3-dienoate |
| SMILES | CC1(C)[C@@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)[C@H](OC(=O)C=C=CCc1ccccc1)C2 |
| InChI | InChI=1S/C27H30O4S/c1-26(2)22-17-18-27(26,20-32(29,30)23-14-7-4-8-15-23)24(19-22)31-25(28)16-10-9-13-21-11-5-3-6-12-21/h3-9,11-12,14-16,22,24H,13,17-20H2,1-2H3/t10?,22-,24-,27+/m1/s1 |
| InChIKey | SGNQOXYFVOHZGS-DAYADPOXSA-N |
| XLogP | 5.15 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|