C18H24OS2 — CID 10471272
O-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] benzylsulfanylmethanethioate (PubChem CID 10471272) has the molecular formula C18H24OS2 and a molecular weight of 320.52 g/mol. Its IUPAC name is O-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] benzylsulfanylmethanethioate.
| Compound Name | O-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] benzylsulfanylmethanethioate |
|---|---|
| PubChem CID | 10471272 |
| Molecular Formula | C18H24OS2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | O-[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] benzylsulfanylmethanethioate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](OC(=S)SCc1ccccc1)C2 |
| InChI | InChI=1S/C18H24OS2/c1-17(2)14-9-10-18(17,3)15(11-14)19-16(20)21-12-13-7-5-4-6-8-13/h4-8,14-15H,9-12H2,1-3H3/t14-,15+,18+/m1/s1 |
| InChIKey | TTYMRMRBCRDKRY-VKJFTORMSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|