C19H26O2 — CID 70124138
2-(1-methoxy-2-phenylethenoxy)-1,7,7-trimethylbicyclo[2.2.1]heptane (PubChem CID 70124138) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is 2-(1-methoxy-2-phenylethenoxy)-1,7,7-trimethylbicyclo[2.2.1]heptane.
| Compound Name | 2-(1-methoxy-2-phenylethenoxy)-1,7,7-trimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 70124138 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-(1-methoxy-2-phenylethenoxy)-1,7,7-trimethylbicyclo[2.2.1]heptane |
| SMILES | COC(=Cc1ccccc1)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C19H26O2/c1-18(2)15-10-11-19(18,3)16(13-15)21-17(20-4)12-14-8-6-5-7-9-14/h5-9,12,15-16H,10-11,13H2,1-4H3 |
| InChIKey | OYZZRLHGQQTTFZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|