C20H24O2S — CID 15189893
[(1S,2R,4R)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl] 3-phenylprop-2-ynoate (PubChem CID 15189893) has the molecular formula C20H24O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is [(1S,2R,4R)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl] 3-phenylprop-2-ynoate.
| Compound Name | [(1S,2R,4R)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl] 3-phenylprop-2-ynoate |
|---|---|
| PubChem CID | 15189893 |
| Molecular Formula | C20H24O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | [(1S,2R,4R)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl] 3-phenylprop-2-ynoate |
| SMILES | CSC[C@]12CC[C@H](C[C@H]1OC(=O)C#Cc1ccccc1)C2(C)C |
| InChI | InChI=1S/C20H24O2S/c1-19(2)16-11-12-20(19,14-23-3)17(13-16)22-18(21)10-9-15-7-5-4-6-8-15/h4-8,16-17H,11-14H2,1-3H3/t16-,17-,20-/m1/s1 |
| InChIKey | IWPNFSAIPPXWHB-MBOZVWFJSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|