C22H30O2S — CID 100929197
(1R,2R,6S,7S)-4-[[(1R,2R,4S)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]oxy]-5-methyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 100929197) has the molecular formula C22H30O2S and a molecular weight of 358.55 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4-[[(1R,2R,4S)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]oxy]-5-methyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1R,2R,6S,7S)-4-[[(1R,2R,4S)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]oxy]-5-methyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 100929197 |
| Molecular Formula | C22H30O2S |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (1R,2R,6S,7S)-4-[[(1R,2R,4S)-7,7-dimethyl-1-(methylsulfanylmethyl)-2-bicyclo[2.2.1]heptanyl]oxy]-5-methyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | CSC[C@@]12CC[C@@H](C[C@H]1OC1=C(C)[C@@H]3[C@H](C1=O)[C@H]1C=C[C@@H]3C1)C2(C)C |
| InChI | InChI=1S/C22H30O2S/c1-12-17-13-5-6-14(9-13)18(17)19(23)20(12)24-16-10-15-7-8-22(16,11-25-4)21(15,2)3/h5-6,13-18H,7-11H2,1-4H3/t13-,14+,15+,16-,17+,18-,22+/m1/s1 |
| InChIKey | NAICLCIYNGPTMC-AECMJYSSSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|