C30H38OS2 — CID 11812820
(1S,2R,6S,7R)-4-[[(1R,2R,4R)-7,7-dimethyl-1-[(2,4,6-trimethylphenyl)methylsulfanylmethyl]-2-bicyclo[2.2.1]heptanyl]sulfanyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 11812820) has the molecular formula C30H38OS2 and a molecular weight of 478.77 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-[[(1R,2R,4R)-7,7-dimethyl-1-[(2,4,6-trimethylphenyl)methylsulfanylmethyl]-2-bicyclo[2.2.1]heptanyl]sulfanyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2R,6S,7R)-4-[[(1R,2R,4R)-7,7-dimethyl-1-[(2,4,6-trimethylphenyl)methylsulfanylmethyl]-2-bicyclo[2.2.1]heptanyl]sulfanyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 11812820 |
| Molecular Formula | C30H38OS2 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (1S,2R,6S,7R)-4-[[(1R,2R,4R)-7,7-dimethyl-1-[(2,4,6-trimethylphenyl)methylsulfanylmethyl]-2-bicyclo[2.2.1]heptanyl]sulfanyl]tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | Cc1cc(C)c(CSC[C@]23CC[C@H](C[C@H]2SC2=C[C@@H]4[C@H](C2=O)[C@@H]2C=C[C@H]4C2)C3(C)C)c(C)c1 |
| InChI | InChI=1S/C30H38OS2/c1-17-10-18(2)24(19(3)11-17)15-32-16-30-9-8-22(29(30,4)5)13-26(30)33-25-14-23-20-6-7-21(12-20)27(23)28(25)31/h6-7,10-11,14,20-23,26-27H,8-9,12-13,15-16H2,1-5H3/t20-,21+,22+,23-,26+,27+,30+/m0/s1 |
| InChIKey | QZZJOICMNCCXDS-XLPMOVFLSA-N |
| XLogP | 7.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|