C10H9IO — CID 166475454
4-iodotricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 166475454) has the molecular formula C10H9IO and a molecular weight of 272.09 g/mol. Its IUPAC name is 4-iodotricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | 4-iodotricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 166475454 |
| Molecular Formula | C10H9IO |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 4-iodotricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C(I)=CC2C3C=CC(C3)C12 |
| InChI | InChI=1S/C10H9IO/c11-8-4-7-5-1-2-6(3-5)9(7)10(8)12/h1-2,4-7,9H,3H2 |
| InChIKey | PUPRGIYLRDIWHI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|