C13H13IO2 — CID 166475440
4-(1-methyl-1λ5-ioda-3-oxacyclobuta-1,4-dien-2-yl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 166475440) has the molecular formula C13H13IO2 and a molecular weight of 328.15 g/mol. Its IUPAC name is 4-(1-methyl-1λ5-ioda-3-oxacyclobuta-1,4-dien-2-yl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | 4-(1-methyl-1λ5-ioda-3-oxacyclobuta-1,4-dien-2-yl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 166475440 |
| Molecular Formula | C13H13IO2 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 4-(1-methyl-1λ5-ioda-3-oxacyclobuta-1,4-dien-2-yl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | CI1=COC=1C1=CC2C3C=CC(C3)C2C1=O |
| InChI | InChI=1S/C13H13IO2/c1-14-6-16-13(14)10-5-9-7-2-3-8(4-7)11(9)12(10)15/h2-3,5-9,11H,4H2,1H3 |
| InChIKey | XLTVUCRQZDYJJC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|