C11H12O2 — CID 10965057
(1R,2S,6S,7S)-4-(hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 10965057) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is (1R,2S,6S,7S)-4-(hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1R,2S,6S,7S)-4-(hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 10965057 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1R,2S,6S,7S)-4-(hydroxymethyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C(CO)=C[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C11H12O2/c12-5-8-4-9-6-1-2-7(3-6)10(9)11(8)13/h1-2,4,6-7,9-10,12H,3,5H2/t6-,7+,9-,10+/m1/s1 |
| InChIKey | RFOGNILKHXAVHA-KDDQHCCQSA-N |
| XLogP | 0.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|