C12H14N3ORf- — CID 166475480
amino-[(Z)-2-amino-2-[(2S,6S)-5-oxo-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]ethenyl]azanide;rutherfordium (PubChem CID 166475480) has the molecular formula C12H14N3ORf- and a molecular weight of 483.26 g/mol. Its IUPAC name is amino-[(Z)-2-amino-2-[(2S,6S)-5-oxo-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]ethenyl]azanide;rutherfordium.
| Compound Name | amino-[(Z)-2-amino-2-[(2S,6S)-5-oxo-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]ethenyl]azanide;rutherfordium |
|---|---|
| PubChem CID | 166475480 |
| Molecular Formula | C12H14N3ORf- |
| Molecular Weight | 483.26 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | amino-[(Z)-2-amino-2-[(2S,6S)-5-oxo-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]ethenyl]azanide;rutherfordium |
| SMILES | N[N-]/C=C(\N)C1=C[C@@H]2C3C=CC(C3)[C@@H]2C1=O.[Rf] |
| InChI | InChI=1S/C12H14N3O.Rf/c13-10(5-15-14)9-4-8-6-1-2-7(3-6)11(8)12(9)16;/h1-2,4-8,11H,3,13-14H2;/q-1;/b10-5-;/t6?,7?,8-,11+;/m1./s1 |
| InChIKey | XDAFXJKRIGXHGV-MWZYRTNXSA-N |
| XLogP | 0.98 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|