C13H18OS — CID 142809064
(2S,6R)-4-(trimethyl-λ4-sulfanyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 142809064) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is (2S,6R)-4-(trimethyl-λ4-sulfanyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (2S,6R)-4-(trimethyl-λ4-sulfanyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 142809064 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2S,6R)-4-(trimethyl-λ4-sulfanyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | CS(C)(C)C1=C[C@@H]2C3C=CC(C3)[C@@H]2C1=O |
| InChI | InChI=1S/C13H18OS/c1-15(2,3)11-7-10-8-4-5-9(6-8)12(10)13(11)14/h4-5,7-10,12H,6H2,1-3H3/t8?,9?,10-,12+/m1/s1 |
| InChIKey | IILHTXKFMMFRDT-PTFDWCFRSA-N |
| XLogP | 2.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|