C17H15FO — CID 166475494
4-cyclohexa-1,3-dien-5-yn-1-yltricyclo[5.2.1.02,6]deca-4,8-dien-3-one;fluoromethane (PubChem CID 166475494) has the molecular formula C17H15FO and a molecular weight of 254.30 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-5-yn-1-yltricyclo[5.2.1.02,6]deca-4,8-dien-3-one;fluoromethane.
| Compound Name | 4-cyclohexa-1,3-dien-5-yn-1-yltricyclo[5.2.1.02,6]deca-4,8-dien-3-one;fluoromethane |
|---|---|
| PubChem CID | 166475494 |
| Molecular Formula | C17H15FO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-cyclohexa-1,3-dien-5-yn-1-yltricyclo[5.2.1.02,6]deca-4,8-dien-3-one;fluoromethane |
| SMILES | CF.O=C1C(c2c#cccc2)=CC2C3C=CC(C3)C12 |
| InChI | InChI=1S/C16H12O.CH3F/c17-16-14(10-4-2-1-3-5-10)9-13-11-6-7-12(8-11)15(13)16;1-2/h1-2,4,6-7,9,11-13,15H,8H2;1H3 |
| InChIKey | UMDOAMKIOAPAIH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|