C19H17F2NO2 — CID 102263614
N-benzyl-2,2-difluoro-2-[(1S,2R,6R,7R)-5-oxo-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]acetamide (PubChem CID 102263614) has the molecular formula C19H17F2NO2 and a molecular weight of 329.35 g/mol. Its IUPAC name is N-benzyl-2,2-difluoro-2-[(1S,2R,6R,7R)-5-oxo-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]acetamide.
| Compound Name | N-benzyl-2,2-difluoro-2-[(1S,2R,6R,7R)-5-oxo-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]acetamide |
|---|---|
| PubChem CID | 102263614 |
| Molecular Formula | C19H17F2NO2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-benzyl-2,2-difluoro-2-[(1S,2R,6R,7R)-5-oxo-4-tricyclo[5.2.1.02,6]deca-3,8-dienyl]acetamide |
| SMILES | O=C1C(C(F)(F)C(=O)NCc2ccccc2)=C[C@@H]2[C@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C19H17F2NO2/c20-19(21,18(24)22-10-11-4-2-1-3-5-11)15-9-14-12-6-7-13(8-12)16(14)17(15)23/h1-7,9,12-14,16H,8,10H2,(H,22,24)/t12-,13+,14+,16-/m1/s1 |
| InChIKey | YDTAEXJAIXGHAI-ORIJERBGSA-N |
| XLogP | 2.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|