C15H19F3N2O — CID 32534298
1-benzyl-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea (PubChem CID 32534298) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 1-benzyl-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-benzyl-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 32534298 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-benzyl-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea |
| SMILES | O=C(NCc1ccccc1)N[C@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C15H19F3N2O/c16-15(17,18)12-7-4-8-13(9-12)20-14(21)19-10-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2,(H2,19,20,21)/t12-,13-/m0/s1 |
| InChIKey | NDKCIQMEVPXAKO-STQMWFEESA-N |
| XLogP | 3.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |