C16H20F4N2O2 — CID 110893358
1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[3-(trifluoromethyl)cyclohexyl]urea (PubChem CID 110893358) has the molecular formula C16H20F4N2O2 and a molecular weight of 348.34 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[3-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[3-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 110893358 |
| Molecular Formula | C16H20F4N2O2 |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-3-[3-(trifluoromethyl)cyclohexyl]urea |
| SMILES | O=C(NCC(O)c1ccc(F)cc1)NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C16H20F4N2O2/c17-12-6-4-10(5-7-12)14(23)9-21-15(24)22-13-3-1-2-11(8-13)16(18,19)20/h4-7,11,13-14,23H,1-3,8-9H2,(H2,21,22,24) |
| InChIKey | LDSPEIPITJOMHX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |