C15H19F3N2O2 — CID 36969496
1-phenylmethoxy-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea (PubChem CID 36969496) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-phenylmethoxy-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-phenylmethoxy-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 36969496 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-phenylmethoxy-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea |
| SMILES | O=C(NOCc1ccccc1)N[C@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C15H19F3N2O2/c16-15(17,18)12-7-4-8-13(9-12)19-14(21)20-22-10-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2,(H2,19,20,21)/t12-,13-/m0/s1 |
| InChIKey | GTMUFYKRDDDVAY-STQMWFEESA-N |
| XLogP | 3.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|