C13H15F4N3O — CID 99601286
1-(5-fluoro-2-pyridinyl)-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea (PubChem CID 99601286) has the molecular formula C13H15F4N3O and a molecular weight of 305.27 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 99601286 |
| Molecular Formula | C13H15F4N3O |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-3-[(1S,3S)-3-(trifluoromethyl)cyclohexyl]urea |
| SMILES | O=C(Nc1ccc(F)cn1)N[C@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C13H15F4N3O/c14-9-4-5-11(18-7-9)20-12(21)19-10-3-1-2-8(6-10)13(15,16)17/h4-5,7-8,10H,1-3,6H2,(H2,18,19,20,21)/t8-,10-/m0/s1 |
| InChIKey | KWIXELCGBLSGDD-WPRPVWTQSA-N |
| XLogP | 3.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |