C15H18FN5O2 — CID 129477020
1-(5-fluoro-2-pyridinyl)-3-[(2R,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]urea (PubChem CID 129477020) has the molecular formula C15H18FN5O2 and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-3-[(2R,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]urea.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-3-[(2R,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]urea |
|---|---|
| PubChem CID | 129477020 |
| Molecular Formula | C15H18FN5O2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-3-[(2R,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]urea |
| SMILES | Cn1cncc1[C@H]1C[C@H](NC(=O)Nc2ccc(F)cn2)CCO1 |
| InChI | InChI=1S/C15H18FN5O2/c1-21-9-17-8-12(21)13-6-11(4-5-23-13)19-15(22)20-14-3-2-10(16)7-18-14/h2-3,7-9,11,13H,4-6H2,1H3,(H2,18,19,20,22)/t11-,13-/m1/s1 |
| InChIKey | JGKMFRWKKJUGFZ-DGCLKSJQSA-N |
| XLogP | 2.00 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |