C18H23N3O3 — CID 128994960
(2R)-2-methoxy-N-[2-(3-methylimidazol-4-yl)oxan-4-yl]-2-phenylacetamide (PubChem CID 128994960) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2R)-2-methoxy-N-[2-(3-methylimidazol-4-yl)oxan-4-yl]-2-phenylacetamide.
| Compound Name | (2R)-2-methoxy-N-[2-(3-methylimidazol-4-yl)oxan-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 128994960 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2R)-2-methoxy-N-[2-(3-methylimidazol-4-yl)oxan-4-yl]-2-phenylacetamide |
| SMILES | CO[C@@H](C(=O)NC1CCOC(c2cncn2C)C1)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O3/c1-21-12-19-11-15(21)16-10-14(8-9-24-16)20-18(22)17(23-2)13-6-4-3-5-7-13/h3-7,11-12,14,16-17H,8-10H2,1-2H3,(H,20,22)/t14?,16?,17-/m1/s1 |
| InChIKey | CWZPMACDUZLLLW-BDVYOWHSSA-N |
| XLogP | 2.14 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |