C15H20N4O2S — CID 129472543
1-[(2R,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]-3-(thiophen-3-ylmethyl)urea (PubChem CID 129472543) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-[(2R,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]-3-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-[(2R,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]-3-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 129472543 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[(2R,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]-3-(thiophen-3-ylmethyl)urea |
| SMILES | Cn1cncc1[C@H]1C[C@H](NC(=O)NCc2ccsc2)CCO1 |
| InChI | InChI=1S/C15H20N4O2S/c1-19-10-16-8-13(19)14-6-12(2-4-21-14)18-15(20)17-7-11-3-5-22-9-11/h3,5,8-10,12,14H,2,4,6-7H2,1H3,(H2,17,18,20)/t12-,14-/m1/s1 |
| InChIKey | LMDZKWCEYCKUOJ-TZMCWYRMSA-N |
| XLogP | 2.20 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |