C17H26N4O2 — CID 129476576
1-[2-(cyclopenten-1-yl)ethyl]-3-[(2S,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]urea (PubChem CID 129476576) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[2-(cyclopenten-1-yl)ethyl]-3-[(2S,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]urea.
| Compound Name | 1-[2-(cyclopenten-1-yl)ethyl]-3-[(2S,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]urea |
|---|---|
| PubChem CID | 129476576 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-[2-(cyclopenten-1-yl)ethyl]-3-[(2S,4R)-2-(3-methylimidazol-4-yl)oxan-4-yl]urea |
| SMILES | Cn1cncc1[C@@H]1C[C@H](NC(=O)NCCC2=CCCC2)CCO1 |
| InChI | InChI=1S/C17H26N4O2/c1-21-12-18-11-15(21)16-10-14(7-9-23-16)20-17(22)19-8-6-13-4-2-3-5-13/h4,11-12,14,16H,2-3,5-10H2,1H3,(H2,19,20,22)/t14-,16+/m1/s1 |
| InChIKey | XKUHEGOBKRQTIN-ZBFHGGJFSA-N |
| XLogP | 2.44 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|