C10H9F3N2O2 — CID 71671968
N-(benzylcarbamoyl)-2,2,2-trifluoroacetamide (PubChem CID 71671968) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(benzylcarbamoyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 71671968 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-(benzylcarbamoyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O2/c11-10(12,13)8(16)15-9(17)14-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,14,15,16,17) |
| InChIKey | PLANWYJVYJMHLO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |