C15H9F12NO3 — CID 159927010
8-(benzylamino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoic acid (PubChem CID 159927010) has the molecular formula C15H9F12NO3 and a molecular weight of 479.22 g/mol. Its IUPAC name is 8-(benzylamino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoic acid.
| Compound Name | 8-(benzylamino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoic acid |
|---|---|
| PubChem CID | 159927010 |
| Molecular Formula | C15H9F12NO3 |
| Molecular Weight | 479.22 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 8-(benzylamino)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-8-oxooctanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H9F12NO3/c16-10(17,8(29)28-6-7-4-2-1-3-5-7)12(20,21)14(24,25)15(26,27)13(22,23)11(18,19)9(30)31/h1-5H,6H2,(H,28,29)(H,30,31) |
| InChIKey | DRHUZWOOYQYCAU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|