C13H8F12N2O — CID 3357198
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-(pyridin-4-ylmethyl)heptanamide (PubChem CID 3357198) has the molecular formula C13H8F12N2O and a molecular weight of 436.20 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-(pyridin-4-ylmethyl)heptanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-(pyridin-4-ylmethyl)heptanamide |
|---|---|
| PubChem CID | 3357198 |
| Molecular Formula | C13H8F12N2O |
| Molecular Weight | 436.20 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-(pyridin-4-ylmethyl)heptanamide |
| SMILES | O=C(NCc1ccncc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H8F12N2O/c14-7(15)9(16,17)11(20,21)13(24,25)12(22,23)10(18,19)8(28)27-5-6-1-3-26-4-2-6/h1-4,7H,5H2,(H,27,28) |
| InChIKey | VPDLVROBDPQRLI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|