C11H6Cl2F7NO — CID 4159508
N-[(3,4-dichlorophenyl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 4159508) has the molecular formula C11H6Cl2F7NO and a molecular weight of 372.07 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 4159508 |
| Molecular Formula | C11H6Cl2F7NO |
| Molecular Weight | 372.07 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(NCc1ccc(Cl)c(Cl)c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H6Cl2F7NO/c12-6-2-1-5(3-7(6)13)4-21-8(22)9(14,15)10(16,17)11(18,19)20/h1-3H,4H2,(H,21,22) |
| InChIKey | WDINOHRKZONZOO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.07 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|