C20H14Cl2F7N3O2 — CID 17310964
N-[3-[(E)-N-[[2-(3,4-dichlorophenyl)acetyl]amino]-C-methylcarbonimidoyl]phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 17310964) has the molecular formula C20H14Cl2F7N3O2 and a molecular weight of 532.24 g/mol. Its IUPAC name is N-[3-[(E)-N-[[2-(3,4-dichlorophenyl)acetyl]amino]-C-methylcarbonimidoyl]phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[3-[(E)-N-[[2-(3,4-dichlorophenyl)acetyl]amino]-C-methylcarbonimidoyl]phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 17310964 |
| Molecular Formula | C20H14Cl2F7N3O2 |
| Molecular Weight | 532.24 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | N-[3-[(E)-N-[[2-(3,4-dichlorophenyl)acetyl]amino]-C-methylcarbonimidoyl]phenyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | C/C(=N\NC(=O)Cc1ccc(Cl)c(Cl)c1)c1cccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H14Cl2F7N3O2/c1-10(31-32-16(33)8-11-5-6-14(21)15(22)7-11)12-3-2-4-13(9-12)30-17(34)18(23,24)19(25,26)20(27,28)29/h2-7,9H,8H2,1H3,(H,30,34)(H,32,33)/b31-10+ |
| InChIKey | JBCKNKXXPDFVDE-VNTWQREPSA-N |
| XLogP | 5.85 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.24 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|