C19H13ClF7N3O3 — CID 17337873
4-chloro-N-[(E)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-2-hydroxybenzamide (PubChem CID 17337873) has the molecular formula C19H13ClF7N3O3 and a molecular weight of 499.77 g/mol. Its IUPAC name is 4-chloro-N-[(E)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-2-hydroxybenzamide.
| Compound Name | 4-chloro-N-[(E)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 17337873 |
| Molecular Formula | C19H13ClF7N3O3 |
| Molecular Weight | 499.77 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | 4-chloro-N-[(E)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-2-hydroxybenzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(Cl)cc1O)c1cccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13ClF7N3O3/c1-9(29-30-15(32)13-6-5-11(20)8-14(13)31)10-3-2-4-12(7-10)28-16(33)17(21,22)18(23,24)19(25,26)27/h2-8,31H,1H3,(H,28,33)(H,30,32)/b29-9+ |
| InChIKey | BSHICDDTKGZYIA-GESPGMLMSA-N |
| XLogP | 4.97 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.77 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|