C30H23F7N4O2 — CID 17337917
2-(2,4-dimethylphenyl)-N-[(E)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]quinoline-4-carboxamide (PubChem CID 17337917) has the molecular formula C30H23F7N4O2 and a molecular weight of 604.53 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-[(E)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-[(E)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 17337917 |
| Molecular Formula | C30H23F7N4O2 |
| Molecular Weight | 604.53 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-[(E)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]quinoline-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cc(-c2ccc(C)cc2C)nc2ccccc12)c1cccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C30H23F7N4O2/c1-16-11-12-21(17(2)13-16)25-15-23(22-9-4-5-10-24(22)39-25)26(42)41-40-18(3)19-7-6-8-20(14-19)38-27(43)28(31,32)29(33,34)30(35,36)37/h4-15H,1-3H3,(H,38,43)(H,41,42)/b40-18+ |
| InChIKey | PVBCPPILZSLTAZ-VWRJOHBLSA-N |
| XLogP | 7.44 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.53 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|