C27H26N4O3S — CID 17349546
2-(3,4-dimethylphenyl)-N-[(E)-1-[3-(methanesulfonamido)phenyl]ethylideneamino]quinoline-4-carboxamide (PubChem CID 17349546) has the molecular formula C27H26N4O3S and a molecular weight of 486.60 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-[(E)-1-[3-(methanesulfonamido)phenyl]ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)-N-[(E)-1-[3-(methanesulfonamido)phenyl]ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 17349546 |
| Molecular Formula | C27H26N4O3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-[(E)-1-[3-(methanesulfonamido)phenyl]ethylideneamino]quinoline-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cc(-c2ccc(C)c(C)c2)nc2ccccc12)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C27H26N4O3S/c1-17-12-13-21(14-18(17)2)26-16-24(23-10-5-6-11-25(23)28-26)27(32)30-29-19(3)20-8-7-9-22(15-20)31-35(4,33)34/h5-16,31H,1-4H3,(H,30,32)/b29-19+ |
| InChIKey | NQHBZXIAJUQNGK-VUTHCHCSSA-N |
| XLogP | 5.04 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|