C27H20ClF3N4O2 — CID 17337998
2-(4-chlorophenyl)-8-methyl-N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]quinoline-4-carboxamide (PubChem CID 17337998) has the molecular formula C27H20ClF3N4O2 and a molecular weight of 524.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-8-methyl-N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-8-methyl-N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 17337998 |
| Molecular Formula | C27H20ClF3N4O2 |
| Molecular Weight | 524.93 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 2-(4-chlorophenyl)-8-methyl-N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]quinoline-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cc(-c2ccc(Cl)cc2)nc2c(C)cccc12)c1cccc(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H20ClF3N4O2/c1-15-5-3-8-21-22(14-23(33-24(15)21)17-9-11-19(28)12-10-17)25(36)35-34-16(2)18-6-4-7-20(13-18)32-26(37)27(29,30)31/h3-14H,1-2H3,(H,32,37)(H,35,36)/b34-16+ |
| InChIKey | RCYZSNJZEDOUQJ-AABVJFSESA-N |
| XLogP | 6.52 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.93 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|