C28H24ClN3O3 — CID 17259950
2-(4-chlorophenyl)-8-methyl-N-[3-(morpholine-4-carbonyl)phenyl]quinoline-4-carboxamide (PubChem CID 17259950) has the molecular formula C28H24ClN3O3 and a molecular weight of 485.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-8-methyl-N-[3-(morpholine-4-carbonyl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-8-methyl-N-[3-(morpholine-4-carbonyl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 17259950 |
| Molecular Formula | C28H24ClN3O3 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-(4-chlorophenyl)-8-methyl-N-[3-(morpholine-4-carbonyl)phenyl]quinoline-4-carboxamide |
| SMILES | Cc1cccc2c(C(=O)Nc3cccc(C(=O)N4CCOCC4)c3)cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C28H24ClN3O3/c1-18-4-2-7-23-24(17-25(31-26(18)23)19-8-10-21(29)11-9-19)27(33)30-22-6-3-5-20(16-22)28(34)32-12-14-35-15-13-32/h2-11,16-17H,12-15H2,1H3,(H,30,33) |
| InChIKey | RQTSRYZZCUBWPC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |