C24H23N3O4 — CID 55797116
6-(3-methylphenyl)-N-[3-(morpholine-4-carbonyl)phenyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 55797116) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 6-(3-methylphenyl)-N-[3-(morpholine-4-carbonyl)phenyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 6-(3-methylphenyl)-N-[3-(morpholine-4-carbonyl)phenyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55797116 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 6-(3-methylphenyl)-N-[3-(morpholine-4-carbonyl)phenyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cccc(-c2ccc(C(=O)Nc3cccc(C(=O)N4CCOCC4)c3)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C24H23N3O4/c1-16-4-2-5-17(14-16)21-9-8-20(23(29)26-21)22(28)25-19-7-3-6-18(15-19)24(30)27-10-12-31-13-11-27/h2-9,14-15H,10-13H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | HZMTVMJTAPHBKU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |