C20H19N3O4S — CID 55791169
N-[4-(methanesulfonamido)phenyl]-6-(3-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 55791169) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is N-[4-(methanesulfonamido)phenyl]-6-(3-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(methanesulfonamido)phenyl]-6-(3-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55791169 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[4-(methanesulfonamido)phenyl]-6-(3-methylphenyl)-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cccc(-c2ccc(C(=O)Nc3ccc(NS(C)(=O)=O)cc3)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C20H19N3O4S/c1-13-4-3-5-14(12-13)18-11-10-17(20(25)22-18)19(24)21-15-6-8-16(9-7-15)23-28(2,26)27/h3-12,23H,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | UJMVHDRVZNMVKC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |