C28H22ClF3N4O2 — CID 17310976
8-chloro-2-(4-ethylphenyl)-N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]quinoline-4-carboxamide (PubChem CID 17310976) has the molecular formula C28H22ClF3N4O2 and a molecular weight of 538.96 g/mol. Its IUPAC name is 8-chloro-2-(4-ethylphenyl)-N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 8-chloro-2-(4-ethylphenyl)-N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 17310976 |
| Molecular Formula | C28H22ClF3N4O2 |
| Molecular Weight | 538.96 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 8-chloro-2-(4-ethylphenyl)-N-[(E)-1-[3-[(2,2,2-trifluoroacetyl)amino]phenyl]ethylideneamino]quinoline-4-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)N/N=C(\C)c3cccc(NC(=O)C(F)(F)F)c3)c3cccc(Cl)c3n2)cc1 |
| InChI | InChI=1S/C28H22ClF3N4O2/c1-3-17-10-12-18(13-11-17)24-15-22(21-8-5-9-23(29)25(21)34-24)26(37)36-35-16(2)19-6-4-7-20(14-19)33-27(38)28(30,31)32/h4-15H,3H2,1-2H3,(H,33,38)(H,36,37)/b35-16+ |
| InChIKey | NSKWGOKAPUZELC-QNVXDBMFSA-N |
| XLogP | 6.77 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.96 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|