C29H28ClN3O2 — CID 17338089
8-chloro-2-(4-ethylphenyl)-N-[(E)-1-(4-propan-2-yloxyphenyl)ethylideneamino]quinoline-4-carboxamide (PubChem CID 17338089) has the molecular formula C29H28ClN3O2 and a molecular weight of 486.02 g/mol. Its IUPAC name is 8-chloro-2-(4-ethylphenyl)-N-[(E)-1-(4-propan-2-yloxyphenyl)ethylideneamino]quinoline-4-carboxamide.
| Compound Name | 8-chloro-2-(4-ethylphenyl)-N-[(E)-1-(4-propan-2-yloxyphenyl)ethylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 17338089 |
| Molecular Formula | C29H28ClN3O2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 8-chloro-2-(4-ethylphenyl)-N-[(E)-1-(4-propan-2-yloxyphenyl)ethylideneamino]quinoline-4-carboxamide |
| SMILES | CCc1ccc(-c2cc(C(=O)N/N=C(\C)c3ccc(OC(C)C)cc3)c3cccc(Cl)c3n2)cc1 |
| InChI | InChI=1S/C29H28ClN3O2/c1-5-20-9-11-22(12-10-20)27-17-25(24-7-6-8-26(30)28(24)31-27)29(34)33-32-19(4)21-13-15-23(16-14-21)35-18(2)3/h6-18H,5H2,1-4H3,(H,33,34)/b32-19+ |
| InChIKey | QBWCCMFBYJNTEP-BIZUNTBRSA-N |
| XLogP | 7.06 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|