C23H16F7N3O3 — CID 28692623
N-[(Z)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-2-hydroxynaphthalene-1-carboxamide (PubChem CID 28692623) has the molecular formula C23H16F7N3O3 and a molecular weight of 515.39 g/mol. Its IUPAC name is N-[(Z)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-2-hydroxynaphthalene-1-carboxamide.
| Compound Name | N-[(Z)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-2-hydroxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 28692623 |
| Molecular Formula | C23H16F7N3O3 |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | N-[(Z)-1-[3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl]ethylideneamino]-2-hydroxynaphthalene-1-carboxamide |
| SMILES | C/C(=N/NC(=O)c1c(O)ccc2ccccc12)c1cccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C23H16F7N3O3/c1-12(32-33-19(35)18-16-8-3-2-5-13(16)9-10-17(18)34)14-6-4-7-15(11-14)31-20(36)21(24,25)22(26,27)23(28,29)30/h2-11,34H,1H3,(H,31,36)(H,33,35)/b32-12- |
| InChIKey | SOUZIWPDSKFWTB-ULTCEKQJSA-N |
| XLogP | 5.47 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|