C15H9Cl4NO3 — CID 157035965
2,6-dichloro-4-[(3,4-dichlorophenyl)methylcarbamoyl]benzoic acid (PubChem CID 157035965) has the molecular formula C15H9Cl4NO3 and a molecular weight of 393.05 g/mol. Its IUPAC name is 2,6-dichloro-4-[(3,4-dichlorophenyl)methylcarbamoyl]benzoic acid.
| Compound Name | 2,6-dichloro-4-[(3,4-dichlorophenyl)methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 157035965 |
| Molecular Formula | C15H9Cl4NO3 |
| Molecular Weight | 393.05 g/mol |
| Exact Mass | 390.93 |
| IUPAC Name | 2,6-dichloro-4-[(3,4-dichlorophenyl)methylcarbamoyl]benzoic acid |
| SMILES | O=C(NCc1ccc(Cl)c(Cl)c1)c1cc(Cl)c(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl4NO3/c16-9-2-1-7(3-10(9)17)6-20-14(21)8-4-11(18)13(15(22)23)12(19)5-8/h1-5H,6H2,(H,20,21)(H,22,23) |
| InChIKey | GRZNCFIBHAVWGS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.05 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |