C22H19Cl2N3O2 — CID 175587638
N-[(3,4-dichlorophenyl)methyl]benzamide;(E)-3-pyridin-4-ylprop-2-enamide (PubChem CID 175587638) has the molecular formula C22H19Cl2N3O2 and a molecular weight of 428.32 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]benzamide;(E)-3-pyridin-4-ylprop-2-enamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]benzamide;(E)-3-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 175587638 |
| Molecular Formula | C22H19Cl2N3O2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]benzamide;(E)-3-pyridin-4-ylprop-2-enamide |
| SMILES | NC(=O)/C=C/c1ccncc1.O=C(NCc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C14H11Cl2NO.C8H8N2O/c15-12-7-6-10(8-13(12)16)9-17-14(18)11-4-2-1-3-5-11;9-8(11)2-1-7-3-5-10-6-4-7/h1-8H,9H2,(H,17,18);1-6H,(H2,9,11)/b;2-1+ |
| InChIKey | AGGFBWIBWWUROR-WLHGVMLRSA-N |
| XLogP | 4.50 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|