C10H9Cl2N5O — CID 70492189
5-amino-N-[(3,4-dichlorophenyl)methyl]-2H-triazole-4-carboxamide (PubChem CID 70492189) has the molecular formula C10H9Cl2N5O and a molecular weight of 286.12 g/mol. Its IUPAC name is 5-amino-N-[(3,4-dichlorophenyl)methyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-amino-N-[(3,4-dichlorophenyl)methyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 70492189 |
| Molecular Formula | C10H9Cl2N5O |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 5-amino-N-[(3,4-dichlorophenyl)methyl]-2H-triazole-4-carboxamide |
| SMILES | Nc1n[nH]nc1C(=O)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2N5O/c11-6-2-1-5(3-7(6)12)4-14-10(18)8-9(13)16-17-15-8/h1-3H,4H2,(H,14,18)(H3,13,15,16,17) |
| InChIKey | YHMYVMDMWBCRAT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |