C16H13Cl2NO4 — CID 70676769
3-[(3,4-dichlorophenyl)methylcarbamoyl]-2-methoxybenzoic acid (PubChem CID 70676769) has the molecular formula C16H13Cl2NO4 and a molecular weight of 354.19 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylcarbamoyl]-2-methoxybenzoic acid.
| Compound Name | 3-[(3,4-dichlorophenyl)methylcarbamoyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 70676769 |
| Molecular Formula | C16H13Cl2NO4 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylcarbamoyl]-2-methoxybenzoic acid |
| SMILES | COc1c(C(=O)O)cccc1C(=O)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2NO4/c1-23-14-10(3-2-4-11(14)16(21)22)15(20)19-8-9-5-6-12(17)13(18)7-9/h2-7H,8H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | KJHFFJDJSGIVMD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |